About 4-cyclohexyl-1H-azepine
4-cyclohexyl-1H-azepine (PubChem CID 89406123) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 4-cyclohexyl-1H-azepine.
Molecular Properties
| Compound Name | 4-cyclohexyl-1H-azepine |
| PubChem CID | 89406123 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-cyclohexyl-1H-azepine |
| SMILES | C1=CNC=CC(C2CCCCC2)=C1 |
| InChI | InChI=1S/C12H17N/c1-2-5-11(6-3-1)12-7-4-9-13-10-8-12/h4,7-11,13H,1-3,5-6H2 |
| InChIKey | IHFTYZRQCMNFHI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexyl-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-1H-azepine?
The IUPAC name of 4-cyclohexyl-1H-azepine (CID 89406123) is 4-cyclohexyl-1H-azepine.
What is the SMILES notation for 4-cyclohexyl-1H-azepine?
The canonical SMILES for 4-cyclohexyl-1H-azepine is C1=CNC=CC(C2CCCCC2)=C1.
What is the InChIKey of 4-cyclohexyl-1H-azepine?
The InChIKey is IHFTYZRQCMNFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-2-5-11(6-3-1)12-7-4-9-13-10-8-12/h4,7-11,13H,1-3,5-6H2.
What are the key properties of 4-cyclohexyl-1H-azepine?
4-cyclohexyl-1H-azepine has a molecular weight of 175.28 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-1H-azepine is sourced from PubChem (CID 89406123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).