About 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one
1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one (PubChem CID 89406142) has the molecular formula C9H9N2O2-
and a molecular weight of 177.18 g/mol. Its IUPAC name is 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 89406142 |
| Molecular Formula | C9H9N2O2- |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CNCc2ccccc2N1[O-] |
| InChI | InChI=1S/C9H9N2O2/c12-9-6-10-5-7-3-1-2-4-8(7)11(9)13/h1-4,10H,5-6H2/q-1 |
| InChIKey | KZOMNIHBYYNHHG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one (CID 89406142) is 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one is O=C1CNCc2ccccc2N1[O-].
What is the InChIKey of 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one?
The InChIKey is KZOMNIHBYYNHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N2O2/c12-9-6-10-5-7-3-1-2-4-8(7)11(9)13/h1-4,10H,5-6H2/q-1.
What are the key properties of 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one?
1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one has a molecular weight of 177.18 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-4,5-dihydro-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 89406142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).