C22H16F3IN6O2 — CID 89406247
4-[[3-[4-(iodomethyl)-3-(trifluoromethyl)anilino]-1,2,4-benzotriazin-7-yl]oxy]-N-methylpyridine-2-carboxamide (PubChem CID 89406247) has the molecular formula C22H16F3IN6O2 and a molecular weight of 580.31 g/mol. Its IUPAC name is 4-[[3-[4-(iodomethyl)-3-(trifluoromethyl)anilino]-1,2,4-benzotriazin-7-yl]oxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[[3-[4-(iodomethyl)-3-(trifluoromethyl)anilino]-1,2,4-benzotriazin-7-yl]oxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 89406247 |
| Molecular Formula | C22H16F3IN6O2 |
| Molecular Weight | 580.31 g/mol |
| Exact Mass | 580.03 |
| IUPAC Name | 4-[[3-[4-(iodomethyl)-3-(trifluoromethyl)anilino]-1,2,4-benzotriazin-7-yl]oxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3nc(Nc4ccc(CI)c(C(F)(F)F)c4)nnc3c2)ccn1 |
| InChI | InChI=1S/C22H16F3IN6O2/c1-27-20(33)19-10-15(6-7-28-19)34-14-4-5-17-18(9-14)31-32-21(30-17)29-13-3-2-12(11-26)16(8-13)22(23,24)25/h2-10H,11H2,1H3,(H,27,33)(H,29,30,32) |
| InChIKey | WBKMVUMJUPCYMT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|