C23H18F3IN6O2 — CID 89406249
4-[4-[[5-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 89406249) has the molecular formula C23H18F3IN6O2 and a molecular weight of 594.34 g/mol. Its IUPAC name is 4-[4-[[5-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[5-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 89406249 |
| Molecular Formula | C23H18F3IN6O2 |
| Molecular Weight | 594.34 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | 4-[4-[[5-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(Nc3n[nH]c(-c4ccc(CI)c(C(F)(F)F)c4)n3)cc2)ccn1 |
| InChI | InChI=1S/C23H18F3IN6O2/c1-28-21(34)19-11-17(8-9-29-19)35-16-6-4-15(5-7-16)30-22-31-20(32-33-22)13-2-3-14(12-27)18(10-13)23(24,25)26/h2-11H,12H2,1H3,(H,28,34)(H2,30,31,32,33) |
| InChIKey | QDHDHCDOSKHFHO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|