C20H41NO — CID 89406316
2-(2,2-dimethylhexyl)-N-ethyl-3,3-dimethyloctanamide (PubChem CID 89406316) has the molecular formula C20H41NO and a molecular weight of 311.55 g/mol. Its IUPAC name is 2-(2,2-dimethylhexyl)-N-ethyl-3,3-dimethyloctanamide.
| Compound Name | 2-(2,2-dimethylhexyl)-N-ethyl-3,3-dimethyloctanamide |
|---|---|
| PubChem CID | 89406316 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | 2-(2,2-dimethylhexyl)-N-ethyl-3,3-dimethyloctanamide |
| SMILES | CCCCCC(C)(C)C(CC(C)(C)CCCC)C(=O)NCC |
| InChI | InChI=1S/C20H41NO/c1-8-11-13-15-20(6,7)17(18(22)21-10-3)16-19(4,5)14-12-9-2/h17H,8-16H2,1-7H3,(H,21,22) |
| InChIKey | TXOUKSNLKUBCIF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|