C13H18F12O3Si — CID 89407213
4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorodecan-3-yl(trimethoxy)silane (PubChem CID 89407213) has the molecular formula C13H18F12O3Si and a molecular weight of 478.35 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorodecan-3-yl(trimethoxy)silane.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorodecan-3-yl(trimethoxy)silane |
|---|---|
| PubChem CID | 89407213 |
| Molecular Formula | C13H18F12O3Si |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorodecan-3-yl(trimethoxy)silane |
| SMILES | CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)F)[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H18F12O3Si/c1-6-7(29(26-3,27-4)28-5)9(16,17)11(20,21)13(24,25)12(22,23)10(18,19)8(2,14)15/h7H,6H2,1-5H3 |
| InChIKey | LJRWVHRTNDLECJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|