C17H26BCl2NO2 — CID 89407290
N,N-bis(2-chloroethyl)-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 89407290) has the molecular formula C17H26BCl2NO2 and a molecular weight of 358.12 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N,N-bis(2-chloroethyl)-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 89407290 |
| Molecular Formula | C17H26BCl2NO2 |
| Molecular Weight | 358.12 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N,N-bis(2-chloroethyl)-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | Cc1cc(N(CCCl)CCCl)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H26BCl2NO2/c1-13-12-14(21(10-8-19)11-9-20)6-7-15(13)18-22-16(2,3)17(4,5)23-18/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | QDKWDOKSNTUPLW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.12 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|