About 3-pyridin-3-ylbenzoyl azide
3-pyridin-3-ylbenzoyl azide (PubChem CID 89407530) has the molecular formula C12H8N4O
and a molecular weight of 224.22 g/mol. Its IUPAC name is 3-pyridin-3-ylbenzoyl azide.
Molecular Properties
| Compound Name | 3-pyridin-3-ylbenzoyl azide |
| PubChem CID | 89407530 |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-pyridin-3-ylbenzoyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C12H8N4O/c13-16-15-12(17)10-4-1-3-9(7-10)11-5-2-6-14-8-11/h1-8H |
| InChIKey | IRZPQGZUSNMMAM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-3-ylbenzoyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-ylbenzoyl azide?
The IUPAC name of 3-pyridin-3-ylbenzoyl azide (CID 89407530) is 3-pyridin-3-ylbenzoyl azide.
What is the SMILES notation for 3-pyridin-3-ylbenzoyl azide?
The canonical SMILES for 3-pyridin-3-ylbenzoyl azide is [N-]=[N+]=NC(=O)c1cccc(-c2cccnc2)c1.
What is the InChIKey of 3-pyridin-3-ylbenzoyl azide?
The InChIKey is IRZPQGZUSNMMAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O/c13-16-15-12(17)10-4-1-3-9(7-10)11-5-2-6-14-8-11/h1-8H.
What are the key properties of 3-pyridin-3-ylbenzoyl azide?
3-pyridin-3-ylbenzoyl azide has a molecular weight of 224.22 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-ylbenzoyl azide is sourced from PubChem (CID 89407530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).