About 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane
1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane (PubChem CID 89407566) has the molecular formula C16H32Cl2O
and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane.
Molecular Properties
| Compound Name | 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane |
| PubChem CID | 89407566 |
| Molecular Formula | C16H32Cl2O |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane |
| SMILES | CCCC(C)(C)C(CCl)OC(CCl)C(C)(C)CCC |
| InChI | InChI=1S/C16H32Cl2O/c1-7-9-15(3,4)13(11-17)19-14(12-18)16(5,6)10-8-2/h13-14H,7-12H2,1-6H3 |
| InChIKey | ZDSTZKXGTVRXGZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane?
The IUPAC name of 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane (CID 89407566) is 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane.
What is the SMILES notation for 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane?
The canonical SMILES for 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane is CCCC(C)(C)C(CCl)OC(CCl)C(C)(C)CCC.
What is the InChIKey of 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane?
The InChIKey is ZDSTZKXGTVRXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32Cl2O/c1-7-9-15(3,4)13(11-17)19-14(12-18)16(5,6)10-8-2/h13-14H,7-12H2,1-6H3.
What are the key properties of 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane?
1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane has a molecular weight of 311.34 g/mol, XLogP of 5.87, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(1-chloro-3,3-dimethylhexan-2-yl)oxy-3,3-dimethylhexane is sourced from PubChem (CID 89407566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).