About (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one
(1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one (PubChem CID 89408127) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one.
Analyze (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one?
The IUPAC name of (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one (CID 89408127) is (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one.
What is the SMILES notation for (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one?
The canonical SMILES for (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one is O=c1ncc2c([nH]1)[C@H]1CCC2C1.
What is the InChIKey of (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one?
The InChIKey is ISBBZWCXPODTJM-GDVGLLTNSA-N. The full InChI is InChI=1S/C9H10N2O/c12-9-10-4-7-5-1-2-6(3-5)8(7)11-9/h4-6H,1-3H2,(H,10,11,12)/t5?,6-/m0/s1.
What are the key properties of (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one?
(1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one has a molecular weight of 162.19 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),5-dien-4-one is sourced from PubChem (CID 89408127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).