C15H14FNO3 — CID 894086
2-(4-fluorophenoxy)-N-(2-hydroxy-5-methylphenyl)acetamide (PubChem CID 894086) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(2-hydroxy-5-methylphenyl)acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(2-hydroxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 894086 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(2-hydroxy-5-methylphenyl)acetamide |
| SMILES | Cc1ccc(O)c(NC(=O)COc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H14FNO3/c1-10-2-7-14(18)13(8-10)17-15(19)9-20-12-5-3-11(16)4-6-12/h2-8,18H,9H2,1H3,(H,17,19) |
| InChIKey | WSANPOYMMUQEGR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|