About 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol
4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol (PubChem CID 89408771) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol |
| PubChem CID | 89408771 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol |
| SMILES | N/N=N/C1=CCC(S)C=C1 |
| InChI | InChI=1S/C6H9N3S/c7-9-8-5-1-3-6(10)4-2-5/h1-3,6,10H,4H2,(H2,7,8) |
| InChIKey | ORACHAJCCGVDIB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol?
The IUPAC name of 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol (CID 89408771) is 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol.
What is the SMILES notation for 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol?
The canonical SMILES for 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol is N/N=N/C1=CCC(S)C=C1.
What is the InChIKey of 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol?
The InChIKey is ORACHAJCCGVDIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c7-9-8-5-1-3-6(10)4-2-5/h1-3,6,10H,4H2,(H2,7,8).
What are the key properties of 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol?
4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol has a molecular weight of 155.23 g/mol, XLogP of 1.45, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminodiazenyl)cyclohexa-2,4-diene-1-thiol is sourced from PubChem (CID 89408771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).