C44H36FN3 — CID 89408812
N-(2-fluorophenyl)-N-[4-[(E)-2-(2,3,9,9-tetramethyl-1-phenylindeno[1,2-f]indol-7-yl)ethenyl]phenyl]pyridin-2-amine (PubChem CID 89408812) has the molecular formula C44H36FN3 and a molecular weight of 625.79 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-[4-[(E)-2-(2,3,9,9-tetramethyl-1-phenylindeno[1,2-f]indol-7-yl)ethenyl]phenyl]pyridin-2-amine.
| Compound Name | N-(2-fluorophenyl)-N-[4-[(E)-2-(2,3,9,9-tetramethyl-1-phenylindeno[1,2-f]indol-7-yl)ethenyl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 89408812 |
| Molecular Formula | C44H36FN3 |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | N-(2-fluorophenyl)-N-[4-[(E)-2-(2,3,9,9-tetramethyl-1-phenylindeno[1,2-f]indol-7-yl)ethenyl]phenyl]pyridin-2-amine |
| SMILES | Cc1c(C)n(-c2ccccc2)c2cc3c(cc12)-c1ccc(/C=C/c2ccc(N(c4ccccn4)c4ccccc4F)cc2)cc1C3(C)C |
| InChI | InChI=1S/C44H36FN3/c1-29-30(2)47(33-12-6-5-7-13-33)42-28-39-37(27-36(29)42)35-24-21-32(26-38(35)44(39,3)4)18-17-31-19-22-34(23-20-31)48(43-16-10-11-25-46-43)41-15-9-8-14-40(41)45/h5-28H,1-4H3/b18-17+ |
| InChIKey | YLALQYQBZKYDKM-ISLYRVAYSA-N |
| XLogP | 11.73 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|