About 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol
2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol (PubChem CID 89408952) has the molecular formula C17H29BrOS
and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol.
Molecular Properties
| Compound Name | 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol |
| PubChem CID | 89408952 |
| Molecular Formula | C17H29BrOS |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol |
| SMILES | CCS(CC)(CC)c1cc(C(C)(C)C)cc(CBr)c1O |
| InChI | InChI=1S/C17H29BrOS/c1-7-20(8-2,9-3)15-11-14(17(4,5)6)10-13(12-18)16(15)19/h10-11,19H,7-9,12H2,1-6H3 |
| InChIKey | AGDGPCRJMICLCQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol?
The IUPAC name of 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol (CID 89408952) is 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol.
What is the SMILES notation for 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol?
The canonical SMILES for 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol is CCS(CC)(CC)c1cc(C(C)(C)C)cc(CBr)c1O.
What is the InChIKey of 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol?
The InChIKey is AGDGPCRJMICLCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29BrOS/c1-7-20(8-2,9-3)15-11-14(17(4,5)6)10-13(12-18)16(15)19/h10-11,19H,7-9,12H2,1-6H3.
What are the key properties of 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol?
2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol has a molecular weight of 361.39 g/mol, XLogP of 5.81, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-4-tert-butyl-6-(triethyl-λ4-sulfanyl)phenol is sourced from PubChem (CID 89408952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).