About 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane
2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane (PubChem CID 89409188) has the molecular formula C9H10F8O2
and a molecular weight of 302.16 g/mol. Its IUPAC name is 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane.
Molecular Properties
| Compound Name | 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane |
| PubChem CID | 89409188 |
| Molecular Formula | C9H10F8O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane |
| SMILES | CC1CC(F)C(OC(F)(F)F)(OC(F)(F)F)C(F)C1 |
| InChI | InChI=1S/C9H10F8O2/c1-4-2-5(10)7(6(11)3-4,18-8(12,13)14)19-9(15,16)17/h4-6H,2-3H2,1H3 |
| InChIKey | FRIKETVFXFKSBD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane?
The IUPAC name of 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane (CID 89409188) is 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane.
What is the SMILES notation for 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane?
The canonical SMILES for 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane is CC1CC(F)C(OC(F)(F)F)(OC(F)(F)F)C(F)C1.
What is the InChIKey of 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane?
The InChIKey is FRIKETVFXFKSBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F8O2/c1-4-2-5(10)7(6(11)3-4,18-8(12,13)14)19-9(15,16)17/h4-6H,2-3H2,1H3.
What are the key properties of 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane?
2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane has a molecular weight of 302.16 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-4-methyl-1,1-bis(trifluoromethoxy)cyclohexane is sourced from PubChem (CID 89409188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).