About 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole
2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole (PubChem CID 89409491) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole.
Molecular Properties
| Compound Name | 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole |
| PubChem CID | 89409491 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole |
| SMILES | C=C1CCC2=C1N=C(C)C2 |
| InChI | InChI=1S/C9H11N/c1-6-3-4-8-5-7(2)10-9(6)8/h1,3-5H2,2H3 |
| InChIKey | JWLWAKSZCZMIQX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole?
The IUPAC name of 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole (CID 89409491) is 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole.
What is the SMILES notation for 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole?
The canonical SMILES for 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole is C=C1CCC2=C1N=C(C)C2.
What is the InChIKey of 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole?
The InChIKey is JWLWAKSZCZMIQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-6-3-4-8-5-7(2)10-9(6)8/h1,3-5H2,2H3.
What are the key properties of 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole?
2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole has a molecular weight of 133.19 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-methylidene-4,5-dihydro-3H-cyclopenta[b]pyrrole is sourced from PubChem (CID 89409491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).