About 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one
2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one (PubChem CID 89409498) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one.
Molecular Properties
| Compound Name | 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one |
| PubChem CID | 89409498 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one |
| SMILES | CC1=NC2=C(CCC2=O)C1 |
| InChI | InChI=1S/C8H9NO/c1-5-4-6-2-3-7(10)8(6)9-5/h2-4H2,1H3 |
| InChIKey | YTYPHONRTPFRDN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one?
The IUPAC name of 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one (CID 89409498) is 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one.
What is the SMILES notation for 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one?
The canonical SMILES for 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one is CC1=NC2=C(CCC2=O)C1.
What is the InChIKey of 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one?
The InChIKey is YTYPHONRTPFRDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c1-5-4-6-2-3-7(10)8(6)9-5/h2-4H2,1H3.
What are the key properties of 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one?
2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one has a molecular weight of 135.17 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5-dihydro-3H-cyclopenta[b]pyrrol-6-one is sourced from PubChem (CID 89409498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).