C12H13F11O2 — CID 89409584
1,1,1,4,5,5,5-heptafluoro-2-(2-methoxyethoxy)-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene (PubChem CID 89409584) has the molecular formula C12H13F11O2 and a molecular weight of 398.21 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-2-(2-methoxyethoxy)-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-2-(2-methoxyethoxy)-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene |
|---|---|
| PubChem CID | 89409584 |
| Molecular Formula | C12H13F11O2 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-2-(2-methoxyethoxy)-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene |
| SMILES | COCCOC(=C(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H13F11O2/c1-8(13,11(18,19)20)6(9(2,14)12(21,22)23)7(10(15,16)17)25-5-4-24-3/h4-5H2,1-3H3 |
| InChIKey | VPDWMNRDJKAXFQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|