About iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate
iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate (PubChem CID 89409625) has the molecular formula C12H14IO4P
and a molecular weight of 380.12 g/mol. Its IUPAC name is iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate.
Molecular Properties
| Compound Name | iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate |
| PubChem CID | 89409625 |
| Molecular Formula | C12H14IO4P |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate |
| SMILES | C=CCOCc1c(OC)cccc1C(=O)OPI |
| InChI | InChI=1S/C12H14IO4P/c1-3-7-16-8-10-9(12(14)17-18-13)5-4-6-11(10)15-2/h3-6,18H,1,7-8H2,2H3 |
| InChIKey | UKCOVHBEEIUMGQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate?
The IUPAC name of iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate (CID 89409625) is iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate.
What is the SMILES notation for iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate?
The canonical SMILES for iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate is C=CCOCc1c(OC)cccc1C(=O)OPI.
What is the InChIKey of iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate?
The InChIKey is UKCOVHBEEIUMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14IO4P/c1-3-7-16-8-10-9(12(14)17-18-13)5-4-6-11(10)15-2/h3-6,18H,1,7-8H2,2H3.
What are the key properties of iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate?
iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate has a molecular weight of 380.12 g/mol, XLogP of 3.50, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iodophosphanyl 3-methoxy-2-(prop-2-enoxymethyl)benzoate is sourced from PubChem (CID 89409625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).