C5H6N4O3 — CID 89409733
8-hydroxy-3,7,8,9-tetrahydropurine-2,6-dione (PubChem CID 89409733) has the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. Its IUPAC name is 8-hydroxy-3,7,8,9-tetrahydropurine-2,6-dione.
| Compound Name | 8-hydroxy-3,7,8,9-tetrahydropurine-2,6-dione |
|---|---|
| PubChem CID | 89409733 |
| Molecular Formula | C5H6N4O3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 8-hydroxy-3,7,8,9-tetrahydropurine-2,6-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)NC(O)N2 |
| InChI | InChI=1S/C5H6N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h4,6,11H,(H3,7,8,9,10,12) |
| InChIKey | KYKVXIJTQOYZLY-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |