C18H33N3O8 — CID 89409820
2-[2-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethoxy]acetic acid (PubChem CID 89409820) has the molecular formula C18H33N3O8 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[2-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 89409820 |
| Molecular Formula | C18H33N3O8 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-[2-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-2-oxoethoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCN(CCNC(=O)OC(C)(C)C)C(=O)COCC(=O)O |
| InChI | InChI=1S/C18H33N3O8/c1-17(2,3)28-15(25)19-7-9-21(13(22)11-27-12-14(23)24)10-8-20-16(26)29-18(4,5)6/h7-12H2,1-6H3,(H,19,25)(H,20,26)(H,23,24) |
| InChIKey | DAVDLFWMFDIXNC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |