C32H31F3IN3O3Si — CID 89409985
5-[6-(iodomethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (PubChem CID 89409985) has the molecular formula C32H31F3IN3O3Si and a molecular weight of 717.60 g/mol. Its IUPAC name is 5-[6-(iodomethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | 5-[6-(iodomethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 89409985 |
| Molecular Formula | C32H31F3IN3O3Si |
| Molecular Weight | 717.60 g/mol |
| Exact Mass | 717.11 |
| IUPAC Name | 5-[6-(iodomethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Oc3cccc4c(C(=O)Nc5cccc(C(F)(F)F)c5)cccc34)cc(CI)nc21 |
| InChI | InChI=1S/C32H31F3IN3O3Si/c1-43(2,3)16-15-41-20-39-14-13-27-29(18-23(19-36)37-30(27)39)42-28-12-6-9-24-25(28)10-5-11-26(24)31(40)38-22-8-4-7-21(17-22)32(33,34)35/h4-14,17-18H,15-16,19-20H2,1-3H3,(H,38,40) |
| InChIKey | UQCBOUCLOXDICS-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.60 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|