About 4-methyl-4-phenylazepane
4-methyl-4-phenylazepane (PubChem CID 89410025) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 4-methyl-4-phenylazepane.
Molecular Properties
| Compound Name | 4-methyl-4-phenylazepane |
| PubChem CID | 89410025 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4-methyl-4-phenylazepane |
| SMILES | CC1(c2ccccc2)CCCNCC1 |
| InChI | InChI=1S/C13H19N/c1-13(8-5-10-14-11-9-13)12-6-3-2-4-7-12/h2-4,6-7,14H,5,8-11H2,1H3 |
| InChIKey | XROKUYOSRDIQDC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-4-phenylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-phenylazepane?
The IUPAC name of 4-methyl-4-phenylazepane (CID 89410025) is 4-methyl-4-phenylazepane.
What is the SMILES notation for 4-methyl-4-phenylazepane?
The canonical SMILES for 4-methyl-4-phenylazepane is CC1(c2ccccc2)CCCNCC1.
What is the InChIKey of 4-methyl-4-phenylazepane?
The InChIKey is XROKUYOSRDIQDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-13(8-5-10-14-11-9-13)12-6-3-2-4-7-12/h2-4,6-7,14H,5,8-11H2,1H3.
What are the key properties of 4-methyl-4-phenylazepane?
4-methyl-4-phenylazepane has a molecular weight of 189.30 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-phenylazepane is sourced from PubChem (CID 89410025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).