About 2-methyl-3,6-dihydro-2H-thiopyran-6-ol
2-methyl-3,6-dihydro-2H-thiopyran-6-ol (PubChem CID 89410051) has the molecular formula C6H10OS
and a molecular weight of 130.21 g/mol. Its IUPAC name is 2-methyl-3,6-dihydro-2H-thiopyran-6-ol.
Molecular Properties
| Compound Name | 2-methyl-3,6-dihydro-2H-thiopyran-6-ol |
| PubChem CID | 89410051 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 2-methyl-3,6-dihydro-2H-thiopyran-6-ol |
| SMILES | CC1CC=CC(O)S1 |
| InChI | InChI=1S/C6H10OS/c1-5-3-2-4-6(7)8-5/h2,4-7H,3H2,1H3 |
| InChIKey | SBHCUQHAMPSGDH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,6-dihydro-2H-thiopyran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,6-dihydro-2H-thiopyran-6-ol?
The IUPAC name of 2-methyl-3,6-dihydro-2H-thiopyran-6-ol (CID 89410051) is 2-methyl-3,6-dihydro-2H-thiopyran-6-ol.
What is the SMILES notation for 2-methyl-3,6-dihydro-2H-thiopyran-6-ol?
The canonical SMILES for 2-methyl-3,6-dihydro-2H-thiopyran-6-ol is CC1CC=CC(O)S1.
What is the InChIKey of 2-methyl-3,6-dihydro-2H-thiopyran-6-ol?
The InChIKey is SBHCUQHAMPSGDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS/c1-5-3-2-4-6(7)8-5/h2,4-7H,3H2,1H3.
What are the key properties of 2-methyl-3,6-dihydro-2H-thiopyran-6-ol?
2-methyl-3,6-dihydro-2H-thiopyran-6-ol has a molecular weight of 130.21 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,6-dihydro-2H-thiopyran-6-ol is sourced from PubChem (CID 89410051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).