C16H15ClN2O4 — CID 8941027
(2S)-N-(2-chlorophenyl)-2-(4-methyl-2-nitrophenoxy)propanamide (PubChem CID 8941027) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is (2S)-N-(2-chlorophenyl)-2-(4-methyl-2-nitrophenoxy)propanamide.
| Compound Name | (2S)-N-(2-chlorophenyl)-2-(4-methyl-2-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 8941027 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2S)-N-(2-chlorophenyl)-2-(4-methyl-2-nitrophenoxy)propanamide |
| SMILES | Cc1ccc(O[C@@H](C)C(=O)Nc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15ClN2O4/c1-10-7-8-15(14(9-10)19(21)22)23-11(2)16(20)18-13-6-4-3-5-12(13)17/h3-9,11H,1-2H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | YHOAQXWLCQOCLN-NSHDSACASA-N |
| XLogP | 3.96 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|