About (3E)-4-chloro-2-iminohexa-3,5-dienal
(3E)-4-chloro-2-iminohexa-3,5-dienal (PubChem CID 89410444) has the molecular formula C6H6ClNO
and a molecular weight of 143.57 g/mol. Its IUPAC name is (3E)-4-chloro-2-iminohexa-3,5-dienal.
Molecular Properties
| Compound Name | (3E)-4-chloro-2-iminohexa-3,5-dienal |
| PubChem CID | 89410444 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 g/mol |
| Exact Mass | 143.01 |
| IUPAC Name | (3E)-4-chloro-2-iminohexa-3,5-dienal |
| SMILES | [H]/N=C(C=O)/C=C(/Cl)C=C |
| InChI | InChI=1S/C6H6ClNO/c1-2-5(7)3-6(8)4-9/h2-4,8H,1H2/b5-3+,8-6- |
| InChIKey | PMGGVQSCGOHUNF-GMWFMGJWSA-N |
| XLogP | 1.51 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.57 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-chloro-2-iminohexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-chloro-2-iminohexa-3,5-dienal?
The IUPAC name of (3E)-4-chloro-2-iminohexa-3,5-dienal (CID 89410444) is (3E)-4-chloro-2-iminohexa-3,5-dienal.
What is the SMILES notation for (3E)-4-chloro-2-iminohexa-3,5-dienal?
The canonical SMILES for (3E)-4-chloro-2-iminohexa-3,5-dienal is [H]/N=C(C=O)/C=C(/Cl)C=C.
What is the InChIKey of (3E)-4-chloro-2-iminohexa-3,5-dienal?
The InChIKey is PMGGVQSCGOHUNF-GMWFMGJWSA-N. The full InChI is InChI=1S/C6H6ClNO/c1-2-5(7)3-6(8)4-9/h2-4,8H,1H2/b5-3+,8-6-.
What are the key properties of (3E)-4-chloro-2-iminohexa-3,5-dienal?
(3E)-4-chloro-2-iminohexa-3,5-dienal has a molecular weight of 143.57 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-chloro-2-iminohexa-3,5-dienal is sourced from PubChem (CID 89410444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).