C17H26IN5O3S — CID 89410588
(E)-1-[[6-(iodomethyl)-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-N,N'-dimethylethene-1,2-diamine (PubChem CID 89410588) has the molecular formula C17H26IN5O3S and a molecular weight of 507.40 g/mol. Its IUPAC name is (E)-1-[[6-(iodomethyl)-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-N,N'-dimethylethene-1,2-diamine.
| Compound Name | (E)-1-[[6-(iodomethyl)-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-N,N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 89410588 |
| Molecular Formula | C17H26IN5O3S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | (E)-1-[[6-(iodomethyl)-8-piperazin-1-yl-2,3-dihydro-1,4-benzoxazin-4-yl]sulfonyl]-N,N'-dimethylethene-1,2-diamine |
| SMILES | CN/C=C(\NC)S(=O)(=O)N1CCOc2c(N3CCNCC3)cc(CI)cc21 |
| InChI | InChI=1S/C17H26IN5O3S/c1-19-12-16(20-2)27(24,25)23-7-8-26-17-14(22-5-3-21-4-6-22)9-13(11-18)10-15(17)23/h9-10,12,19-21H,3-8,11H2,1-2H3/b16-12+ |
| InChIKey | IQWXPFLRCBWWTH-FOWTUZBSSA-N |
| XLogP | 0.80 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|