C14H20O — CID 89410828
(2Z,7Z)-4,6-dimethylidene-5-prop-2-enylnona-2,7-dien-5-ol (PubChem CID 89410828) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (2Z,7Z)-4,6-dimethylidene-5-prop-2-enylnona-2,7-dien-5-ol.
| Compound Name | (2Z,7Z)-4,6-dimethylidene-5-prop-2-enylnona-2,7-dien-5-ol |
|---|---|
| PubChem CID | 89410828 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2Z,7Z)-4,6-dimethylidene-5-prop-2-enylnona-2,7-dien-5-ol |
| SMILES | C=CCC(O)(C(=C)/C=C\C)C(=C)/C=C\C |
| InChI | InChI=1S/C14H20O/c1-6-9-12(4)14(15,11-8-3)13(5)10-7-2/h6-10,15H,3-5,11H2,1-2H3/b9-6-,10-7- |
| InChIKey | WFFIIWWYIARTFO-LFPVQMOXSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|