About (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine
(1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 89410890) has the molecular formula C8H11F2N
and a molecular weight of 159.18 g/mol. Its IUPAC name is (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 89410890 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CC(F)(F)C1=C[C@H](N)CC=C1 |
| InChI | InChI=1S/C8H11F2N/c1-8(9,10)6-3-2-4-7(11)5-6/h2-3,5,7H,4,11H2,1H3/t7-/m1/s1 |
| InChIKey | IJGYLLPSSJZIJP-SSDOTTSWSA-N |
| XLogP | 1.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine (CID 89410890) is (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine is CC(F)(F)C1=C[C@H](N)CC=C1.
What is the InChIKey of (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is IJGYLLPSSJZIJP-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H11F2N/c1-8(9,10)6-3-2-4-7(11)5-6/h2-3,5,7H,4,11H2,1H3/t7-/m1/s1.
What are the key properties of (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine?
(1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 159.18 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-(1,1-difluoroethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89410890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).