About 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate
2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate (PubChem CID 89411075) has the molecular formula C24H32F2O5S2
and a molecular weight of 502.65 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate |
| PubChem CID | 89411075 |
| Molecular Formula | C24H32F2O5S2 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate |
| SMILES | CC(C)(OC(=O)CCSc1ccc(OS(=O)(=O)C(C)(F)F)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32F2O5S2/c1-22(2,24-13-16-10-17(14-24)12-18(11-16)15-24)30-21(27)8-9-32-20-6-4-19(5-7-20)31-33(28,29)23(3,25)26/h4-7,16-18H,8-15H2,1-3H3 |
| InChIKey | ZESJXXCSSFAJOG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate?
The IUPAC name of 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate (CID 89411075) is 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate.
What is the SMILES notation for 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate?
The canonical SMILES for 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate is CC(C)(OC(=O)CCSc1ccc(OS(=O)(=O)C(C)(F)F)cc1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate?
The InChIKey is ZESJXXCSSFAJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32F2O5S2/c1-22(2,24-13-16-10-17(14-24)12-18(11-16)15-24)30-21(27)8-9-32-20-6-4-19(5-7-20)31-33(28,29)23(3,25)26/h4-7,16-18H,8-15H2,1-3H3.
What are the key properties of 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate?
2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate has a molecular weight of 502.65 g/mol, XLogP of 6.03, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)propan-2-yl 3-[4-(1,1-difluoroethylsulfonyloxy)phenyl]sulfanylpropanoate is sourced from PubChem (CID 89411075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).