C17H16N2O4 — CID 89411121
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]pyridine-2-carboxamide (PubChem CID 89411121) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]pyridine-2-carboxamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89411121 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]pyridine-2-carboxamide |
| SMILES | O=CCC(NC(=O)c1ccccn1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H16N2O4/c20-8-6-13(19-17(21)14-3-1-2-7-18-14)12-4-5-15-16(11-12)23-10-9-22-15/h1-5,7-8,11,13H,6,9-10H2,(H,19,21) |
| InChIKey | JKUAGTVKZYZCKX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|