C30H36FN5OSi — CID 89411402
3-fluoro-4-[[4-[4-methylidene-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 89411402) has the molecular formula C30H36FN5OSi and a molecular weight of 529.74 g/mol. Its IUPAC name is 3-fluoro-4-[[4-[4-methylidene-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[4-[4-methylidene-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 89411402 |
| Molecular Formula | C30H36FN5OSi |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 3-fluoro-4-[[4-[4-methylidene-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-h][1,6]naphthyridin-1-yl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | C=C1C=CN(C2CCN(Cc3ccc(C#N)cc3F)CC2)c2c1cnc1c2ccn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H36FN5OSi/c1-22-7-14-36(25-8-11-34(12-9-25)20-24-6-5-23(18-32)17-28(24)31)29-26-10-13-35(30(26)33-19-27(22)29)21-37-15-16-38(2,3)4/h5-7,10,13-14,17,19,25H,1,8-9,11-12,15-16,20-21H2,2-4H3 |
| InChIKey | QQPUIWYNTPSASN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 57.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|