C16H26N4O2 — CID 89411525
N-[3-amino-4-[(3-amino-3-oxopropyl)amino]phenyl]-2,2-dimethylpentanamide (PubChem CID 89411525) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[3-amino-4-[(3-amino-3-oxopropyl)amino]phenyl]-2,2-dimethylpentanamide.
| Compound Name | N-[3-amino-4-[(3-amino-3-oxopropyl)amino]phenyl]-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 89411525 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[3-amino-4-[(3-amino-3-oxopropyl)amino]phenyl]-2,2-dimethylpentanamide |
| SMILES | CCCC(C)(C)C(=O)Nc1ccc(NCCC(N)=O)c(N)c1 |
| InChI | InChI=1S/C16H26N4O2/c1-4-8-16(2,3)15(22)20-11-5-6-13(12(17)10-11)19-9-7-14(18)21/h5-6,10,19H,4,7-9,17H2,1-3H3,(H2,18,21)(H,20,22) |
| InChIKey | BWCDVOGYJSVZAH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|