C15H21ClN4O6S — CID 89411643
(3aR,4S,5R,6R)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol (PubChem CID 89411643) has the molecular formula C15H21ClN4O6S and a molecular weight of 420.88 g/mol. Its IUPAC name is (3aR,4S,5R,6R)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol.
| Compound Name | (3aR,4S,5R,6R)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol |
|---|---|
| PubChem CID | 89411643 |
| Molecular Formula | C15H21ClN4O6S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (3aR,4S,5R,6R)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@H]2C3OC(C)(C)O[C@@H]3[C@@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C15H21ClN4O6S/c1-4-5-27-14-18-12(16)7(20(23)24)13(19-14)17-6-8(21)9(22)11-10(6)25-15(2,3)26-11/h6,8-11,21-22H,4-5H2,1-3H3,(H,17,18,19)/t6-,8-,9+,10?,11-/m1/s1 |
| InChIKey | OVBBONDLXLSRBH-BFVOOZHCSA-N |
| XLogP | 1.58 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|