C11H18O2 — CID 89411644
(4R,5S)-4-but-3-en-2-yl-5-ethenyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 89411644) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4R,5S)-4-but-3-en-2-yl-5-ethenyl-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-but-3-en-2-yl-5-ethenyl-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 89411644 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4R,5S)-4-but-3-en-2-yl-5-ethenyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CC(C)[C@H]1OC(C)(C)O[C@H]1C=C |
| InChI | InChI=1S/C11H18O2/c1-6-8(3)10-9(7-2)12-11(4,5)13-10/h6-10H,1-2H2,3-5H3/t8?,9-,10+/m0/s1 |
| InChIKey | OVFNVJMMWSIDKN-CBMCFHRWSA-N |
| XLogP | 2.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|