C21H31ClN4O7S — CID 89411645
N-[(3aR,4S,6R)-4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-amine (PubChem CID 89411645) has the molecular formula C21H31ClN4O7S and a molecular weight of 519.02 g/mol. Its IUPAC name is N-[(3aR,4S,6R)-4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-amine.
| Compound Name | N-[(3aR,4S,6R)-4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 89411645 |
| Molecular Formula | C21H31ClN4O7S |
| Molecular Weight | 519.02 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-[(3aR,4S,6R)-4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-amine |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@@H]2C[C@H](OCC3COC(C)(C)O3)[C@H]3OC(C)(C)OC23)n1 |
| InChI | InChI=1S/C21H31ClN4O7S/c1-6-7-34-19-24-17(22)14(26(27)28)18(25-19)23-12-8-13(16-15(12)32-21(4,5)33-16)29-9-11-10-30-20(2,3)31-11/h11-13,15-16H,6-10H2,1-5H3,(H,23,24,25)/t11?,12-,13+,15?,16-/m1/s1 |
| InChIKey | GBXOVCWJSDFHTA-RUMMTKMLSA-N |
| XLogP | 3.78 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.02 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|