C15H22ClFN4O3S — CID 89411647
(3aR,4R,5R,6S)-6-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (PubChem CID 89411647) has the molecular formula C15H22ClFN4O3S and a molecular weight of 392.88 g/mol. Its IUPAC name is (3aR,4R,5R,6S)-6-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4R,5R,6S)-6-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 89411647 |
| Molecular Formula | C15H22ClFN4O3S |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (3aR,4R,5R,6S)-6-[(5-amino-6-chloro-2-propylsulfanylpyrimidin-4-yl)amino]-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| SMILES | CCCSc1nc(Cl)c(N)c(N[C@H]2C3OC(C)(C)O[C@@H]3[C@@H](O)[C@@H]2F)n1 |
| InChI | InChI=1S/C15H22ClFN4O3S/c1-4-5-25-14-20-12(16)7(18)13(21-14)19-8-6(17)9(22)11-10(8)23-15(2,3)24-11/h6,8-11,22H,4-5,18H2,1-3H3,(H,19,20,21)/t6-,8-,9+,10?,11-/m1/s1 |
| InChIKey | ZSZYHQHLHGRMMO-BFVOOZHCSA-N |
| XLogP | 2.23 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |