C24H25BN2O3S — CID 89411750
CID 89411750 (PubChem CID 89411750) has the molecular formula C24H25BN2O3S and a molecular weight of 432.35 g/mol.
| Compound Name | CID 89411750 |
|---|---|
| PubChem CID | 89411750 |
| Molecular Formula | C24H25BN2O3S |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(COc2ccc(C)cc2-c2csc(N3CCC(CC(=O)OC)C3)n2)cc1 |
| InChI | InChI=1S/C24H25BN2O3S/c1-16-3-8-22(30-14-17-4-6-19(25)7-5-17)20(11-16)21-15-31-24(26-21)27-10-9-18(13-27)12-23(28)29-2/h3-8,11,15,18H,9-10,12-14H2,1-2H3 |
| InChIKey | JWWSTWXZEMYQRF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|