C22H23N7O — CID 89412134
N-[1-[(3-aminophenyl)methyl]pyrazol-4-yl]-6-(1-methylazetidin-3-yl)-1H-indazole-3-carboxamide (PubChem CID 89412134) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[1-[(3-aminophenyl)methyl]pyrazol-4-yl]-6-(1-methylazetidin-3-yl)-1H-indazole-3-carboxamide.
| Compound Name | N-[1-[(3-aminophenyl)methyl]pyrazol-4-yl]-6-(1-methylazetidin-3-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 89412134 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[1-[(3-aminophenyl)methyl]pyrazol-4-yl]-6-(1-methylazetidin-3-yl)-1H-indazole-3-carboxamide |
| SMILES | CN1CC(c2ccc3c(C(=O)Nc4cnn(Cc5cccc(N)c5)c4)n[nH]c3c2)C1 |
| InChI | InChI=1S/C22H23N7O/c1-28-11-16(12-28)15-5-6-19-20(8-15)26-27-21(19)22(30)25-18-9-24-29(13-18)10-14-3-2-4-17(23)7-14/h2-9,13,16H,10-12,23H2,1H3,(H,25,30)(H,26,27) |
| InChIKey | FRQFZXWYYPMRJZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|