C13H19N — CID 89412153
(3E,5Z)-N-(1-cyclopropylethyl)octa-1,3,5,7-tetraen-4-amine (PubChem CID 89412153) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3E,5Z)-N-(1-cyclopropylethyl)octa-1,3,5,7-tetraen-4-amine.
| Compound Name | (3E,5Z)-N-(1-cyclopropylethyl)octa-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 89412153 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3E,5Z)-N-(1-cyclopropylethyl)octa-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(=C/C=C)NC(C)C1CC1 |
| InChI | InChI=1S/C13H19N/c1-4-6-8-13(7-5-2)14-11(3)12-9-10-12/h4-8,11-12,14H,1-2,9-10H2,3H3/b8-6-,13-7+ |
| InChIKey | BOFKLHUFUWVDSL-WNDPTYLVSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|