C15H17F3N2O4 — CID 89412237
1-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]ethenol (PubChem CID 89412237) has the molecular formula C15H17F3N2O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]ethenol.
| Compound Name | 1-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]ethenol |
|---|---|
| PubChem CID | 89412237 |
| Molecular Formula | C15H17F3N2O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[6-(1,4-dioxaspiro[4.5]decan-8-yloxy)-2-(trifluoromethyl)pyrimidin-4-yl]ethenol |
| SMILES | C=C(O)c1cc(OC2CCC3(CC2)OCCO3)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H17F3N2O4/c1-9(21)11-8-12(20-13(19-11)15(16,17)18)24-10-2-4-14(5-3-10)22-6-7-23-14/h8,10,21H,1-7H2 |
| InChIKey | DPZZZLRUTUVJTN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|