C13H10FN3O3 — CID 89412284
(5Z)-1-amino-5-[(E)-3-(2-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 89412284) has the molecular formula C13H10FN3O3 and a molecular weight of 275.24 g/mol. Its IUPAC name is (5Z)-1-amino-5-[(E)-3-(2-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-amino-5-[(E)-3-(2-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 89412284 |
| Molecular Formula | C13H10FN3O3 |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | (5Z)-1-amino-5-[(E)-3-(2-fluorophenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | NN1C(=O)NC(=O)/C(=C/C=C/c2ccccc2F)C1=O |
| InChI | InChI=1S/C13H10FN3O3/c14-10-7-2-1-4-8(10)5-3-6-9-11(18)16-13(20)17(15)12(9)19/h1-7H,15H2,(H,16,18,20)/b5-3+,9-6- |
| InChIKey | PBRWYSNKGMACKN-BWRAOMHSSA-N |
| XLogP | 0.72 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|