C17H28BCl2N2O2+ — CID 89412472
bis(2-chloroethyl)-methyl-[[2-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]methyl]azanium (PubChem CID 89412472) has the molecular formula C17H28BCl2N2O2+ and a molecular weight of 374.14 g/mol. Its IUPAC name is bis(2-chloroethyl)-methyl-[[2-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]methyl]azanium.
| Compound Name | bis(2-chloroethyl)-methyl-[[2-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 89412472 |
| Molecular Formula | C17H28BCl2N2O2+ |
| Molecular Weight | 374.14 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | bis(2-chloroethyl)-methyl-[[2-(6-methyl-1,3,6,2-dioxazaborocan-2-yl)phenyl]methyl]azanium |
| SMILES | CN1CCOB(c2ccccc2C[N+](C)(CCCl)CCCl)OCC1 |
| InChI | InChI=1S/C17H28BCl2N2O2/c1-21-9-13-23-18(24-14-10-21)17-6-4-3-5-16(17)15-22(2,11-7-19)12-8-20/h3-6H,7-15H2,1-2H3/q+1 |
| InChIKey | UJPROWVIPIRBMM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|