About [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate
[(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate (PubChem CID 89412884) has the molecular formula C22H28N4O5
and a molecular weight of 428.49 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate.
Molecular Properties
| Compound Name | [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate |
| PubChem CID | 89412884 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate |
| SMILES | CCOc1cc(NC(=O)Nc2cccc([C@H](C)NC(=O)O[C@H]3CCOC3)c2)ccc1N |
| InChI | InChI=1S/C22H28N4O5/c1-3-30-20-12-17(7-8-19(20)23)26-21(27)25-16-6-4-5-15(11-16)14(2)24-22(28)31-18-9-10-29-13-18/h4-8,11-12,14,18H,3,9-10,13,23H2,1-2H3,(H,24,28)(H2,25,26,27)/t14-,18-/m0/s1 |
| InChIKey | GARABVWDPFUIAL-KSSFIOAISA-N |
| XLogP | 3.89 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate?
The IUPAC name of [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate (CID 89412884) is [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate.
What is the SMILES notation for [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate?
The canonical SMILES for [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate is CCOc1cc(NC(=O)Nc2cccc([C@H](C)NC(=O)O[C@H]3CCOC3)c2)ccc1N.
What is the InChIKey of [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate?
The InChIKey is GARABVWDPFUIAL-KSSFIOAISA-N. The full InChI is InChI=1S/C22H28N4O5/c1-3-30-20-12-17(7-8-19(20)23)26-21(27)25-16-6-4-5-15(11-16)14(2)24-22(28)31-18-9-10-29-13-18/h4-8,11-12,14,18H,3,9-10,13,23H2,1-2H3,(H,24,28)(H2,25,26,27)/t14-,18-/m0/s1.
What are the key properties of [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate?
[(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate has a molecular weight of 428.49 g/mol, XLogP of 3.89, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-oxolan-3-yl] N-[(1S)-1-[3-[(4-amino-3-ethoxyphenyl)carbamoylamino]phenyl]ethyl]carbamate is sourced from PubChem (CID 89412884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).