About oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate
oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate (PubChem CID 89412886) has the molecular formula C22H28N4O5
and a molecular weight of 428.49 g/mol. Its IUPAC name is oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate.
Molecular Properties
| Compound Name | oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate |
| PubChem CID | 89412886 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate |
| SMILES | COc1cc(NC(=O)N(C)c2cccc([C@H](C)NC(=O)OC3CCOC3)c2)ccc1N |
| InChI | InChI=1S/C22H28N4O5/c1-14(24-22(28)31-18-9-10-30-13-18)15-5-4-6-17(11-15)26(2)21(27)25-16-7-8-19(23)20(12-16)29-3/h4-8,11-12,14,18H,9-10,13,23H2,1-3H3,(H,24,28)(H,25,27)/t14-,18?/m0/s1 |
| InChIKey | BSCYRQVXPWVJSQ-PIVQAISJSA-N |
| XLogP | 3.52 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate?
The IUPAC name of oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate (CID 89412886) is oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate.
What is the SMILES notation for oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate?
The canonical SMILES for oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate is COc1cc(NC(=O)N(C)c2cccc([C@H](C)NC(=O)OC3CCOC3)c2)ccc1N.
What is the InChIKey of oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate?
The InChIKey is BSCYRQVXPWVJSQ-PIVQAISJSA-N. The full InChI is InChI=1S/C22H28N4O5/c1-14(24-22(28)31-18-9-10-30-13-18)15-5-4-6-17(11-15)26(2)21(27)25-16-7-8-19(23)20(12-16)29-3/h4-8,11-12,14,18H,9-10,13,23H2,1-3H3,(H,24,28)(H,25,27)/t14-,18?/m0/s1.
What are the key properties of oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate?
oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate has a molecular weight of 428.49 g/mol, XLogP of 3.52, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl N-[(1S)-1-[3-[(4-amino-3-methoxyphenyl)carbamoyl-methylamino]phenyl]ethyl]carbamate is sourced from PubChem (CID 89412886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).