C12H18O6 — CID 89412895
(3S,4S,5S)-4,5-dimethoxy-6-(2-oxopropyl)oxane-2,3-dicarbaldehyde (PubChem CID 89412895) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (3S,4S,5S)-4,5-dimethoxy-6-(2-oxopropyl)oxane-2,3-dicarbaldehyde.
| Compound Name | (3S,4S,5S)-4,5-dimethoxy-6-(2-oxopropyl)oxane-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 89412895 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3S,4S,5S)-4,5-dimethoxy-6-(2-oxopropyl)oxane-2,3-dicarbaldehyde |
| SMILES | CO[C@H]1[C@H](C=O)C(C=O)OC(CC(C)=O)[C@@H]1OC |
| InChI | InChI=1S/C12H18O6/c1-7(15)4-9-12(17-3)11(16-2)8(5-13)10(6-14)18-9/h5-6,8-12H,4H2,1-3H3/t8-,9?,10?,11+,12+/m1/s1 |
| InChIKey | AQAHZQZDBFEZKG-AMFGXWJMSA-N |
| XLogP | -0.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|