C14H22O6 — CID 89412905
(3S,4S,5S)-4,5-dimethoxy-6-(3-methyl-2-oxobutyl)oxane-2,3-dicarbaldehyde (PubChem CID 89412905) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (3S,4S,5S)-4,5-dimethoxy-6-(3-methyl-2-oxobutyl)oxane-2,3-dicarbaldehyde.
| Compound Name | (3S,4S,5S)-4,5-dimethoxy-6-(3-methyl-2-oxobutyl)oxane-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 89412905 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (3S,4S,5S)-4,5-dimethoxy-6-(3-methyl-2-oxobutyl)oxane-2,3-dicarbaldehyde |
| SMILES | CO[C@H]1[C@H](C=O)C(C=O)OC(CC(=O)C(C)C)[C@@H]1OC |
| InChI | InChI=1S/C14H22O6/c1-8(2)10(17)5-11-14(19-4)13(18-3)9(6-15)12(7-16)20-11/h6-9,11-14H,5H2,1-4H3/t9-,11?,12?,13+,14+/m1/s1 |
| InChIKey | ZFIXZEBQXNKEJM-POBVMZDQSA-N |
| XLogP | 0.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|