C20H30ClFN6O3 — CID 89412907
N-[(2R)-3-[2-[2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide (PubChem CID 89412907) has the molecular formula C20H30ClFN6O3 and a molecular weight of 456.95 g/mol. Its IUPAC name is N-[(2R)-3-[2-[2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-3-[2-[2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 89412907 |
| Molecular Formula | C20H30ClFN6O3 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-[(2R)-3-[2-[2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)-5-fluoropyrimidin-4-yl]hydrazinyl]-2-(cyclopentylmethyl)-3-oxopropyl]-N-hydroxyformamide |
| SMILES | CC1(C)CCN(c2nc(Cl)nc(NNC(=O)[C@H](CC3CCCC3)CN(O)C=O)c2F)C1 |
| InChI | InChI=1S/C20H30ClFN6O3/c1-20(2)7-8-27(11-20)17-15(22)16(23-19(21)24-17)25-26-18(30)14(10-28(31)12-29)9-13-5-3-4-6-13/h12-14,31H,3-11H2,1-2H3,(H,26,30)(H,23,24,25)/t14-/m1/s1 |
| InChIKey | JMBSVKYDDQUVPS-CQSZACIVSA-N |
| XLogP | 2.99 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|