C17H31F3O5S — CID 89412914
4-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxy-1,1,2-trifluorobutane-2-sulfonic acid (PubChem CID 89412914) has the molecular formula C17H31F3O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxy-1,1,2-trifluorobutane-2-sulfonic acid.
| Compound Name | 4-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxy-1,1,2-trifluorobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 89412914 |
| Molecular Formula | C17H31F3O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-[4,4-dimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxy-1,1,2-trifluorobutane-2-sulfonic acid |
| SMILES | CCC(C)(C)CC(C(=O)OCCC(F)(C(F)F)S(=O)(=O)O)C(C)(C)CC |
| InChI | InChI=1S/C17H31F3O5S/c1-7-15(3,4)11-12(16(5,6)8-2)13(21)25-10-9-17(20,14(18)19)26(22,23)24/h12,14H,7-11H2,1-6H3,(H,22,23,24) |
| InChIKey | MCASJWYEMIOKEF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|