C19H22N2O6 — CID 8941293
(2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(4-methyl-2-nitrophenoxy)propanamide (PubChem CID 8941293) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(4-methyl-2-nitrophenoxy)propanamide.
| Compound Name | (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(4-methyl-2-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 8941293 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2S)-N-[(3,4-dimethoxyphenyl)methyl]-2-(4-methyl-2-nitrophenoxy)propanamide |
| SMILES | COc1ccc(CNC(=O)[C@H](C)Oc2ccc(C)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H22N2O6/c1-12-5-7-16(15(9-12)21(23)24)27-13(2)19(22)20-11-14-6-8-17(25-3)18(10-14)26-4/h5-10,13H,11H2,1-4H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | XBDAPOFZBWCYJS-ZDUSSCGKSA-N |
| XLogP | 3.00 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|